C10H12N2O5S2 — CID 106185258
2-[5-[(5-oxopyrrolidin-3-yl)sulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 106185258) has the molecular formula C10H12N2O5S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[5-[(5-oxopyrrolidin-3-yl)sulfamoyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(5-oxopyrrolidin-3-yl)sulfamoyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 106185258 |
| Molecular Formula | C10H12N2O5S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[5-[(5-oxopyrrolidin-3-yl)sulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)NC2CNC(=O)C2)s1 |
| InChI | InChI=1S/C10H12N2O5S2/c13-8-3-6(5-11-8)12-19(16,17)10-2-1-7(18-10)4-9(14)15/h1-2,6,12H,3-5H2,(H,11,13)(H,14,15) |
| InChIKey | QUHIRSURWBYNRK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |