C7H9N3O3 — CID 106186467
3-(5-oxopyrrolidin-3-yl)imidazolidine-2,4-dione (PubChem CID 106186467) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3-(5-oxopyrrolidin-3-yl)imidazolidine-2,4-dione.
| Compound Name | 3-(5-oxopyrrolidin-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106186467 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3-(5-oxopyrrolidin-3-yl)imidazolidine-2,4-dione |
| SMILES | O=C1CC(N2C(=O)CNC2=O)CN1 |
| InChI | InChI=1S/C7H9N3O3/c11-5-1-4(2-8-5)10-6(12)3-9-7(10)13/h4H,1-3H2,(H,8,11)(H,9,13) |
| InChIKey | GTDAZNLNVAYXTI-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|