C13H17ClN2O3 — CID 106188968
4-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-2-one (PubChem CID 106188968) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-2-one.
| Compound Name | 4-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106188968 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-[[3-(4-chlorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-2-one |
| SMILES | O=C1CC(NCC(O)COc2ccc(Cl)cc2)CN1 |
| InChI | InChI=1S/C13H17ClN2O3/c14-9-1-3-12(4-2-9)19-8-11(17)7-15-10-5-13(18)16-6-10/h1-4,10-11,15,17H,5-8H2,(H,16,18) |
| InChIKey | YOGRRLWDJFYJAH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |