C14H18Cl2N2O3 — CID 63661388
5-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]piperidin-2-one (PubChem CID 63661388) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is 5-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]piperidin-2-one.
| Compound Name | 5-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 63661388 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-[[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]amino]piperidin-2-one |
| SMILES | O=C1CCC(NCC(O)COc2cc(Cl)ccc2Cl)CN1 |
| InChI | InChI=1S/C14H18Cl2N2O3/c15-9-1-3-12(16)13(5-9)21-8-11(19)7-17-10-2-4-14(20)18-6-10/h1,3,5,10-11,17,19H,2,4,6-8H2,(H,18,20) |
| InChIKey | YQLSXNYRXDOVPQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |