C12H13Br2NO — CID 106189386
3,5-dibromo-N-(3-methylbut-2-enyl)benzamide (PubChem CID 106189386) has the molecular formula C12H13Br2NO and a molecular weight of 347.05 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-methylbut-2-enyl)benzamide.
| Compound Name | 3,5-dibromo-N-(3-methylbut-2-enyl)benzamide |
|---|---|
| PubChem CID | 106189386 |
| Molecular Formula | C12H13Br2NO |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 3,5-dibromo-N-(3-methylbut-2-enyl)benzamide |
| SMILES | CC(C)=CCNC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H13Br2NO/c1-8(2)3-4-15-12(16)9-5-10(13)7-11(14)6-9/h3,5-7H,4H2,1-2H3,(H,15,16) |
| InChIKey | FGSONBXMOSHKIZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|