(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid

C10H19NO3 — CID 106190796

IUPAC(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid
SMILESCC(C)(O)C(C)(C)NC/C=C/C(=O)O
InChIInChI=1S/C10H19NO3/c1-9(2,10(3,4)14)11-7-5-6-8(12)13/h5-6,11,14H,7H2,1-4H3,(H,12,13)/b6-5+
InChIKeyUPPYVQOJEFSXHO-AATRIKPKSA-N
MW201.27 g/mol
LogP0.77
Rot. Bonds5

About (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid

(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid (PubChem CID 106190796) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid.

Molecular Properties

Compound Name(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid
PubChem CID106190796
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid
SMILESCC(C)(O)C(C)(C)NC/C=C/C(=O)O
InChIInChI=1S/C10H19NO3/c1-9(2,10(3,4)14)11-7-5-6-8(12)13/h5-6,11,14H,7H2,1-4H3,(H,12,13)/b6-5+
InChIKeyUPPYVQOJEFSXHO-AATRIKPKSA-N
XLogP0.77
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid?
The IUPAC name of (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid (CID 106190796) is (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid?
The canonical SMILES for (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid is CC(C)(O)C(C)(C)NC/C=C/C(=O)O.
What is the InChIKey of (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid?
The InChIKey is UPPYVQOJEFSXHO-AATRIKPKSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2,10(3,4)14)11-7-5-6-8(12)13/h5-6,11,14H,7H2,1-4H3,(H,12,13)/b6-5+.
What are the key properties of (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid?
(E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid has a molecular weight of 201.27 g/mol, XLogP of 0.77, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]but-2-enoic acid is sourced from PubChem (CID 106190796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).