C11H21NO3 — CID 106351023
(E)-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]but-2-enoic acid (PubChem CID 106351023) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (E)-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]but-2-enoic acid.
| Compound Name | (E)-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 106351023 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (E)-4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]but-2-enoic acid |
| SMILES | CC(C)(C)C(CCO)NC/C=C/C(=O)O |
| InChI | InChI=1S/C11H21NO3/c1-11(2,3)9(6-8-13)12-7-4-5-10(14)15/h4-5,9,12-13H,6-8H2,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | ZXJXVBMTZHUSDQ-SNAWJCMRSA-N |
| XLogP | 1.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|