C23H31NO3 — CID 10619100
(2S,3S,7S,8aR)-7-[(1E,3E)-hepta-1,3-dienyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 10619100) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2S,3S,7S,8aR)-7-[(1E,3E)-hepta-1,3-dienyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (2S,3S,7S,8aR)-7-[(1E,3E)-hepta-1,3-dienyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 10619100 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2S,3S,7S,8aR)-7-[(1E,3E)-hepta-1,3-dienyl]-3-(methoxymethyl)-8a-methyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CCC/C=C/C=C/[C@@H]1CC(=O)N2[C@@H](COC)[C@H](c3ccccc3)O[C@]2(C)C1 |
| InChI | InChI=1S/C23H31NO3/c1-4-5-6-7-9-12-18-15-21(25)24-20(17-26-3)22(27-23(24,2)16-18)19-13-10-8-11-14-19/h6-14,18,20,22H,4-5,15-17H2,1-3H3/b7-6+,12-9+/t18-,20+,22+,23-/m1/s1 |
| InChIKey | WXZQMTIJIKDCLL-JTBBNQEKSA-N |
| XLogP | 4.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|