C13H18N2 — CID 106191346
N-(3-methylbut-2-enyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine (PubChem CID 106191346) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine.
| Compound Name | N-(3-methylbut-2-enyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
|---|---|
| PubChem CID | 106191346 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(3-methylbut-2-enyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
| SMILES | CC(C)=CCNc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C13H18N2/c1-10(2)8-9-14-13-7-6-11-4-3-5-12(11)15-13/h6-8H,3-5,9H2,1-2H3,(H,14,15) |
| InChIKey | WFFYVTIYZSHNSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|