C11H13F3N2S — CID 106430862
N-[2-(trifluoromethylsulfanyl)ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine (PubChem CID 106430862) has the molecular formula C11H13F3N2S and a molecular weight of 262.30 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
|---|---|
| PubChem CID | 106430862 |
| Molecular Formula | C11H13F3N2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]-6,7-dihydro-5H-cyclopenta[b]pyridin-2-amine |
| SMILES | FC(F)(F)SCCNc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C11H13F3N2S/c12-11(13,14)17-7-6-15-10-5-4-8-2-1-3-9(8)16-10/h4-5H,1-3,6-7H2,(H,15,16) |
| InChIKey | XIMYSNYEDFKUKD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|