C12H12N4O3S — CID 106192153
4-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pyrrolidin-2-one (PubChem CID 106192153) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106192153 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pyrrolidin-2-one |
| SMILES | Cc1nc2cc(NC3CNC(=O)C3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C12H12N4O3S/c1-6-14-9-3-8(15-7-2-12(17)13-5-7)10(16(18)19)4-11(9)20-6/h3-4,7,15H,2,5H2,1H3,(H,13,17) |
| InChIKey | XLPKUDHBECUUQY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|