C12H14ClN7 — CID 106194823
5-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 106194823) has the molecular formula C12H14ClN7 and a molecular weight of 291.75 g/mol. Its IUPAC name is 5-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 106194823 |
| Molecular Formula | C12H14ClN7 |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5-chloro-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1[nH]ncc1CCCNc1cc(Cl)nc2ncnn12 |
| InChI | InChI=1S/C12H14ClN7/c1-8-9(6-16-19-8)3-2-4-14-11-5-10(13)18-12-15-7-17-20(11)12/h5-7,14H,2-4H2,1H3,(H,16,19) |
| InChIKey | JUWVJBWPRPYNDX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|