C11H12ClN7 — CID 102918251
5-chloro-N-(3-imidazol-1-ylpropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 102918251) has the molecular formula C11H12ClN7 and a molecular weight of 277.72 g/mol. Its IUPAC name is 5-chloro-N-(3-imidazol-1-ylpropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-(3-imidazol-1-ylpropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 102918251 |
| Molecular Formula | C11H12ClN7 |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-chloro-N-(3-imidazol-1-ylpropyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Clc1cc(NCCCn2ccnc2)n2ncnc2n1 |
| InChI | InChI=1S/C11H12ClN7/c12-9-6-10(19-11(17-9)15-7-16-19)14-2-1-4-18-5-3-13-8-18/h3,5-8,14H,1-2,4H2 |
| InChIKey | YBVFTIHHZFSWEY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|