C24H24N2O3 — CID 10620314
(2E)-2-[cyclohexyl-(4-quinolin-2-ylphenyl)methoxy]iminoacetic acid (PubChem CID 10620314) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2E)-2-[cyclohexyl-(4-quinolin-2-ylphenyl)methoxy]iminoacetic acid.
| Compound Name | (2E)-2-[cyclohexyl-(4-quinolin-2-ylphenyl)methoxy]iminoacetic acid |
|---|---|
| PubChem CID | 10620314 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2E)-2-[cyclohexyl-(4-quinolin-2-ylphenyl)methoxy]iminoacetic acid |
| SMILES | O=C(O)/C=N/OC(c1ccc(-c2ccc3ccccc3n2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H24N2O3/c27-23(28)16-25-29-24(19-7-2-1-3-8-19)20-12-10-18(11-13-20)22-15-14-17-6-4-5-9-21(17)26-22/h4-6,9-16,19,24H,1-3,7-8H2,(H,27,28)/b25-16+ |
| InChIKey | XVMNJMATCPGKNK-PCLIKHOPSA-N |
| XLogP | 5.61 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|