C10H16N4O2 — CID 106203636
2-cyclobutylethyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 106203636) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-cyclobutylethyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
| Compound Name | 2-cyclobutylethyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
|---|---|
| PubChem CID | 106203636 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-cyclobutylethyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | Nc1ncn(CC(=O)OCCC2CCC2)n1 |
| InChI | InChI=1S/C10H16N4O2/c11-10-12-7-14(13-10)6-9(15)16-5-4-8-2-1-3-8/h7-8H,1-6H2,(H2,11,13) |
| InChIKey | RJEGVORMRJAZCO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |