C11H18N4O2 — CID 61309432
(4-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61309432) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (4-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate.
| Compound Name | (4-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
|---|---|
| PubChem CID | 61309432 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (4-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | CC1CCC(OC(=O)Cn2cnc(N)n2)CC1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-2-4-9(5-3-8)17-10(16)6-15-7-13-11(12)14-15/h7-9H,2-6H2,1H3,(H2,12,14) |
| InChIKey | QNIBBWWOJFUGLY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |