C14H18BrIO — CID 106204833
1-bromo-3-[1-(2-cyclobutylethoxy)-2-iodoethyl]benzene (PubChem CID 106204833) has the molecular formula C14H18BrIO and a molecular weight of 409.11 g/mol. Its IUPAC name is 1-bromo-3-[1-(2-cyclobutylethoxy)-2-iodoethyl]benzene.
| Compound Name | 1-bromo-3-[1-(2-cyclobutylethoxy)-2-iodoethyl]benzene |
|---|---|
| PubChem CID | 106204833 |
| Molecular Formula | C14H18BrIO |
| Molecular Weight | 409.11 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 1-bromo-3-[1-(2-cyclobutylethoxy)-2-iodoethyl]benzene |
| SMILES | Brc1cccc(C(CI)OCCC2CCC2)c1 |
| InChI | InChI=1S/C14H18BrIO/c15-13-6-2-5-12(9-13)14(10-16)17-8-7-11-3-1-4-11/h2,5-6,9,11,14H,1,3-4,7-8,10H2 |
| InChIKey | NZVSACDVPQCWDU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|