C10H10BrF2IO — CID 114774748
1-bromo-3-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene (PubChem CID 114774748) has the molecular formula C10H10BrF2IO and a molecular weight of 390.99 g/mol. Its IUPAC name is 1-bromo-3-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene.
| Compound Name | 1-bromo-3-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene |
|---|---|
| PubChem CID | 114774748 |
| Molecular Formula | C10H10BrF2IO |
| Molecular Weight | 390.99 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 1-bromo-3-[1-(2,2-difluoroethoxy)-2-iodoethyl]benzene |
| SMILES | FC(F)COC(CI)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H10BrF2IO/c11-8-3-1-2-7(4-8)9(5-14)15-6-10(12)13/h1-4,9-10H,5-6H2 |
| InChIKey | GLHSIDNMSOTZTG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.99 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|