C10H10F3IO — CID 114774714
1-[1-(2,2-difluoroethoxy)-2-iodoethyl]-3-fluorobenzene (PubChem CID 114774714) has the molecular formula C10H10F3IO and a molecular weight of 330.09 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethoxy)-2-iodoethyl]-3-fluorobenzene.
| Compound Name | 1-[1-(2,2-difluoroethoxy)-2-iodoethyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 114774714 |
| Molecular Formula | C10H10F3IO |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-[1-(2,2-difluoroethoxy)-2-iodoethyl]-3-fluorobenzene |
| SMILES | Fc1cccc(C(CI)OCC(F)F)c1 |
| InChI | InChI=1S/C10H10F3IO/c11-8-3-1-2-7(4-8)9(5-14)15-6-10(12)13/h1-4,9-10H,5-6H2 |
| InChIKey | QPCZRNSQODUBLT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|