C19H17N5O3S — CID 10620700
1-[5-cyano-3-(4-methylphenyl)imidazol-4-yl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 10620700) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is 1-[5-cyano-3-(4-methylphenyl)imidazol-4-yl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[5-cyano-3-(4-methylphenyl)imidazol-4-yl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 10620700 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[5-cyano-3-(4-methylphenyl)imidazol-4-yl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(-n2cnc(C#N)c2NC(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H17N5O3S/c1-13-3-7-15(8-4-13)24-12-21-17(11-20)18(24)22-19(25)23-28(26,27)16-9-5-14(2)6-10-16/h3-10,12H,1-2H3,(H2,22,23,25) |
| InChIKey | PDSQXOIDRHPAIO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |