C14H16N4O4S — CID 110191765
1-(1,4-dimethyl-6-oxopyrimidin-2-yl)-3-(4-methylphenyl)sulfonylurea (PubChem CID 110191765) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 1-(1,4-dimethyl-6-oxopyrimidin-2-yl)-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-(1,4-dimethyl-6-oxopyrimidin-2-yl)-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 110191765 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(1,4-dimethyl-6-oxopyrimidin-2-yl)-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2nc(C)cc(=O)n2C)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-9-4-6-11(7-5-9)23(21,22)17-14(20)16-13-15-10(2)8-12(19)18(13)3/h4-8H,1-3H3,(H2,15,16,17,20) |
| InChIKey | QSKFQFOZRWATKV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |