C11H15F2N3O — CID 106207933
[6-(2-cyclobutylethoxy)-3,5-difluoro-2-pyridinyl]hydrazine (PubChem CID 106207933) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is [6-(2-cyclobutylethoxy)-3,5-difluoro-2-pyridinyl]hydrazine.
| Compound Name | [6-(2-cyclobutylethoxy)-3,5-difluoro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 106207933 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | [6-(2-cyclobutylethoxy)-3,5-difluoro-2-pyridinyl]hydrazine |
| SMILES | NNc1nc(OCCC2CCC2)c(F)cc1F |
| InChI | InChI=1S/C11H15F2N3O/c12-8-6-9(13)11(15-10(8)16-14)17-5-4-7-2-1-3-7/h6-7H,1-5,14H2,(H,15,16) |
| InChIKey | OIIFKBYMIBOOOL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|