C8H11N3O — CID 106209065
4-hex-5-ynyl-1H-1,2,4-triazol-5-one (PubChem CID 106209065) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-hex-5-ynyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-hex-5-ynyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 106209065 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-hex-5-ynyl-1H-1,2,4-triazol-5-one |
| SMILES | C#CCCCCn1cn[nH]c1=O |
| InChI | InChI=1S/C8H11N3O/c1-2-3-4-5-6-11-7-9-10-8(11)12/h1,7H,3-6H2,(H,10,12) |
| InChIKey | MHDJQBOIOGSKJN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|