C7H9N3O — CID 107410928
4-pent-4-yn-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 107410928) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-pent-4-yn-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-pent-4-yn-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 107410928 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 4-pent-4-yn-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | C#CCC(C)n1cn[nH]c1=O |
| InChI | InChI=1S/C7H9N3O/c1-3-4-6(2)10-5-8-9-7(10)11/h1,5-6H,4H2,2H3,(H,9,11) |
| InChIKey | NNVUTFVMBXSGIF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|