C12H17NO2 — CID 106209087
1-hex-5-ynyl-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 106209087) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-hex-5-ynyl-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-hex-5-ynyl-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106209087 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-hex-5-ynyl-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | C#CCCCCN1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C12H17NO2/c1-4-5-6-7-8-13-10(14)9-12(2,3)11(13)15/h1H,5-9H2,2-3H3 |
| InChIKey | YEPIKHVNILYJDG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|