C12H16N2O3 — CID 106211117
1-hex-5-ynyl-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 106211117) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-hex-5-ynyl-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-hex-5-ynyl-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 106211117 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-hex-5-ynyl-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C#CCCCCN1C(=O)NC(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C12H16N2O3/c1-4-5-6-7-8-14-10(16)12(2,3)9(15)13-11(14)17/h1H,5-8H2,2-3H3,(H,13,15,17) |
| InChIKey | PUYPUQODRMASKM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|