C13H21N3O4 — CID 115947616
N-butan-2-yl-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)propanamide (PubChem CID 115947616) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-butan-2-yl-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)propanamide.
| Compound Name | N-butan-2-yl-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 115947616 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-butan-2-yl-3-(5,5-dimethyl-2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
| SMILES | CCC(C)NC(=O)CCN1C(=O)NC(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C13H21N3O4/c1-5-8(2)14-9(17)6-7-16-11(19)13(3,4)10(18)15-12(16)20/h8H,5-7H2,1-4H3,(H,14,17)(H,15,18,20) |
| InChIKey | HYKAYAQLMLLYCP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|