C10H17N3O3 — CID 110703633
N-butan-2-yl-3-(3,5-dioxopyrazolidin-4-yl)propanamide (PubChem CID 110703633) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-butan-2-yl-3-(3,5-dioxopyrazolidin-4-yl)propanamide.
| Compound Name | N-butan-2-yl-3-(3,5-dioxopyrazolidin-4-yl)propanamide |
|---|---|
| PubChem CID | 110703633 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-butan-2-yl-3-(3,5-dioxopyrazolidin-4-yl)propanamide |
| SMILES | CCC(C)NC(=O)CCC1C(=O)NNC1=O |
| InChI | InChI=1S/C10H17N3O3/c1-3-6(2)11-8(14)5-4-7-9(15)12-13-10(7)16/h6-7H,3-5H2,1-2H3,(H,11,14)(H,12,15)(H,13,16) |
| InChIKey | GURLHXHCCBNERG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|