C13H14F5NO — CID 106210355
N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 106210355) has the molecular formula C13H14F5NO and a molecular weight of 295.25 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 106210355 |
| Molecular Formula | C13H14F5NO |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC(NC1(C(F)(F)F)CC1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C13H14F5NO/c1-8(19-12(6-7-12)13(16,17)18)9-4-2-3-5-10(9)20-11(14)15/h2-5,8,11,19H,6-7H2,1H3 |
| InChIKey | VKVRETDHJGVPJQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |