C12H14F3NO2 — CID 106210611
2-[1-[[1-(trifluoromethyl)cyclopropyl]amino]ethyl]benzene-1,4-diol (PubChem CID 106210611) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[1-[[1-(trifluoromethyl)cyclopropyl]amino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[[1-(trifluoromethyl)cyclopropyl]amino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 106210611 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[1-[[1-(trifluoromethyl)cyclopropyl]amino]ethyl]benzene-1,4-diol |
| SMILES | CC(NC1(C(F)(F)F)CC1)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H14F3NO2/c1-7(9-6-8(17)2-3-10(9)18)16-11(4-5-11)12(13,14)15/h2-3,6-7,16-18H,4-5H2,1H3 |
| InChIKey | FSISPJWJIPIADU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|