C13H14F3N5 — CID 106210752
N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 106210752) has the molecular formula C13H14F3N5 and a molecular weight of 297.28 g/mol. Its IUPAC name is N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 106210752 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC(NC1(C(F)(F)F)CC1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C13H14F3N5/c1-9(18-12(5-6-12)13(14,15)16)10-3-2-4-11(7-10)21-8-17-19-20-21/h2-4,7-9,18H,5-6H2,1H3 |
| InChIKey | RXJBBNYXUJFODA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |