C16H23N5 — CID 43194972
2-methyl-N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]cyclohexan-1-amine (PubChem CID 43194972) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-methyl-N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]cyclohexan-1-amine.
| Compound Name | 2-methyl-N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 43194972 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2-methyl-N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]cyclohexan-1-amine |
| SMILES | CC(NC1CCCCC1C)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H23N5/c1-12-6-3-4-9-16(12)18-13(2)14-7-5-8-15(10-14)21-11-17-19-20-21/h5,7-8,10-13,16,18H,3-4,6,9H2,1-2H3 |
| InChIKey | OLTNHEWUCJBMQZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |