C15H22N6 — CID 62536344
N-methyl-1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]piperidin-3-amine (PubChem CID 62536344) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-methyl-1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]piperidin-3-amine.
| Compound Name | N-methyl-1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 62536344 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-methyl-1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]piperidin-3-amine |
| SMILES | CNC1CCCN(C(C)c2cccc(-n3cnnn3)c2)C1 |
| InChI | InChI=1S/C15H22N6/c1-12(20-8-4-6-14(10-20)16-2)13-5-3-7-15(9-13)21-11-17-18-19-21/h3,5,7,9,11-12,14,16H,4,6,8,10H2,1-2H3 |
| InChIKey | DQFMGDMNEJJMRV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |