C12H16N6 — CID 65244795
1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]azetidin-3-amine (PubChem CID 65244795) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]azetidin-3-amine.
| Compound Name | 1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 65244795 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-[1-[3-(tetrazol-1-yl)phenyl]ethyl]azetidin-3-amine |
| SMILES | CC(c1cccc(-n2cnnn2)c1)N1CC(N)C1 |
| InChI | InChI=1S/C12H16N6/c1-9(17-6-11(13)7-17)10-3-2-4-12(5-10)18-8-14-15-16-18/h2-5,8-9,11H,6-7,13H2,1H3 |
| InChIKey | CZSNFWNEIOZSHC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |