C22H29NO6 — CID 10621193
(4S)-4-benzyl-3-[(Z,2S)-2-hydroxy-5-methyl-6-(oxan-2-yloxy)hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 10621193) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(Z,2S)-2-hydroxy-5-methyl-6-(oxan-2-yloxy)hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(Z,2S)-2-hydroxy-5-methyl-6-(oxan-2-yloxy)hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10621193 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4S)-4-benzyl-3-[(Z,2S)-2-hydroxy-5-methyl-6-(oxan-2-yloxy)hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C/C[C@H](O)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)COC1CCCCO1 |
| InChI | InChI=1S/C22H29NO6/c1-16(14-28-20-9-5-6-12-27-20)10-11-19(24)21(25)23-18(15-29-22(23)26)13-17-7-3-2-4-8-17/h2-4,7-8,10,18-20,24H,5-6,9,11-15H2,1H3/b16-10-/t18-,19-,20?/m0/s1 |
| InChIKey | NIHHPZJRCYDYPW-HXPGHZRCSA-N |
| XLogP | 2.82 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|