C26H36N2O6 — CID 76652351
N-[3-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-(cyclohexylmethyl)-3-oxopropyl]-N-(oxan-2-yloxy)formamide (PubChem CID 76652351) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[3-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-(cyclohexylmethyl)-3-oxopropyl]-N-(oxan-2-yloxy)formamide.
| Compound Name | N-[3-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-(cyclohexylmethyl)-3-oxopropyl]-N-(oxan-2-yloxy)formamide |
|---|---|
| PubChem CID | 76652351 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[3-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-(cyclohexylmethyl)-3-oxopropyl]-N-(oxan-2-yloxy)formamide |
| SMILES | O=CN(CC(CC1CCCCC1)C(=O)N1C(=O)OCC1Cc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C26H36N2O6/c29-19-27(34-24-13-7-8-14-32-24)17-22(15-20-9-3-1-4-10-20)25(30)28-23(18-33-26(28)31)16-21-11-5-2-6-12-21/h2,5-6,11-12,19-20,22-24H,1,3-4,7-10,13-18H2 |
| InChIKey | PGHXHUKZYAJHCF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|