C27H37N3O8 — CID 131732108
(3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoyl]-1-phenylmethoxycarbonylpyrazolidine-3-carboxylic acid (PubChem CID 131732108) has the molecular formula C27H37N3O8 and a molecular weight of 531.61 g/mol. Its IUPAC name is (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoyl]-1-phenylmethoxycarbonylpyrazolidine-3-carboxylic acid.
| Compound Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoyl]-1-phenylmethoxycarbonylpyrazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 131732108 |
| Molecular Formula | C27H37N3O8 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoyl]-1-phenylmethoxycarbonylpyrazolidine-3-carboxylic acid |
| SMILES | O=CN(C[C@@H](CC1CCCC1)C(=O)N1[C@H](C(=O)O)CCN1C(=O)OCc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C27H37N3O8/c31-19-28(38-24-12-6-7-15-36-24)17-22(16-20-8-4-5-9-20)25(32)30-23(26(33)34)13-14-29(30)27(35)37-18-21-10-2-1-3-11-21/h1-3,10-11,19-20,22-24H,4-9,12-18H2,(H,33,34)/t22-,23+,24?/m1/s1 |
| InChIKey | HPAWOKGBCDZRPC-NHIDMIJISA-N |
| XLogP | 3.34 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|