C21H40N2O5 — CID 86637011
(2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoic acid;N-propan-2-ylpropan-2-amine (PubChem CID 86637011) has the molecular formula C21H40N2O5 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoic acid;N-propan-2-ylpropan-2-amine.
| Compound Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoic acid;N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 86637011 |
| Molecular Formula | C21H40N2O5 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-3-[formyl(oxan-2-yloxy)amino]propanoic acid;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.O=CN(C[C@@H](CC1CCCC1)C(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C15H25NO5.C6H15N/c17-11-16(21-14-7-3-4-8-20-14)10-13(15(18)19)9-12-5-1-2-6-12;1-5(2)7-6(3)4/h11-14H,1-10H2,(H,18,19);5-7H,1-4H3/t13-,14?;/m1./s1 |
| InChIKey | IETCTZDYCQJBEX-JRLNIEDVSA-N |
| XLogP | 3.58 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|