C19H33NO5 — CID 21256844
2-(cyclohexylmethyl)-3-[formyl(oxan-2-yloxy)amino]hexanoic acid (PubChem CID 21256844) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-3-[formyl(oxan-2-yloxy)amino]hexanoic acid.
| Compound Name | 2-(cyclohexylmethyl)-3-[formyl(oxan-2-yloxy)amino]hexanoic acid |
|---|---|
| PubChem CID | 21256844 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-(cyclohexylmethyl)-3-[formyl(oxan-2-yloxy)amino]hexanoic acid |
| SMILES | CCCC(C(CC1CCCCC1)C(=O)O)N(C=O)OC1CCCCO1 |
| InChI | InChI=1S/C19H33NO5/c1-2-8-17(20(14-21)25-18-11-6-7-12-24-18)16(19(22)23)13-15-9-4-3-5-10-15/h14-18H,2-13H2,1H3,(H,22,23) |
| InChIKey | AWBIKKDYYUWNEQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|