C37H50N6O7S — CID 86757665
benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(oxan-2-yloxy)amino]-2-(3-phenylpropyl)hexanoyl]amino]-6-oxo-6-(1,3,4-thiadiazol-2-ylamino)hexyl]carbamate (PubChem CID 86757665) has the molecular formula C37H50N6O7S and a molecular weight of 722.91 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(oxan-2-yloxy)amino]-2-(3-phenylpropyl)hexanoyl]amino]-6-oxo-6-(1,3,4-thiadiazol-2-ylamino)hexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(oxan-2-yloxy)amino]-2-(3-phenylpropyl)hexanoyl]amino]-6-oxo-6-(1,3,4-thiadiazol-2-ylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 86757665 |
| Molecular Formula | C37H50N6O7S |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | benzyl N-[(5S)-5-[[(2R,3S)-3-[formyl(oxan-2-yloxy)amino]-2-(3-phenylpropyl)hexanoyl]amino]-6-oxo-6-(1,3,4-thiadiazol-2-ylamino)hexyl]carbamate |
| SMILES | CCC[C@@H]([C@@H](CCCc1ccccc1)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)Nc1nncs1)N(C=O)OC1CCCCO1 |
| InChI | InChI=1S/C37H50N6O7S/c1-2-14-32(43(27-44)50-33-22-10-12-24-48-33)30(20-13-19-28-15-5-3-6-16-28)34(45)40-31(35(46)41-36-42-39-26-51-36)21-9-11-23-38-37(47)49-25-29-17-7-4-8-18-29/h3-8,15-18,26-27,30-33H,2,9-14,19-25H2,1H3,(H,38,47)(H,40,45)(H,41,42,46)/t30-,31+,32+,33?/m1/s1 |
| InChIKey | QEFNWOVDEDKNBH-XLEWBJRTSA-N |
| XLogP | 5.78 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|