C11H7BrF4N2S — CID 106215196
6-bromo-5-fluoro-3-[1-(trifluoromethyl)cyclopropyl]-1H-benzimidazole-2-thione (PubChem CID 106215196) has the molecular formula C11H7BrF4N2S and a molecular weight of 355.15 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3-[1-(trifluoromethyl)cyclopropyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-5-fluoro-3-[1-(trifluoromethyl)cyclopropyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106215196 |
| Molecular Formula | C11H7BrF4N2S |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 6-bromo-5-fluoro-3-[1-(trifluoromethyl)cyclopropyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Br)[nH]c(=S)n2C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H7BrF4N2S/c12-5-3-7-8(4-6(5)13)18(9(19)17-7)10(1-2-10)11(14,15)16/h3-4H,1-2H2,(H,17,19) |
| InChIKey | SWULIRMDZROCOG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|