C9H12F3NO2 — CID 106215329
3-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]but-2-enoic acid (PubChem CID 106215329) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is 3-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]but-2-enoic acid.
| Compound Name | 3-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 106215329 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H12F3NO2/c1-6(4-7(14)15)5-13-8(2-3-8)9(10,11)12/h4,13H,2-3,5H2,1H3,(H,14,15) |
| InChIKey | XMXFORWJGMXPEK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|