C11H15F3N2O4 — CID 106216298
4-[methyl-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]amino]oxolane-3-carboxylic acid (PubChem CID 106216298) has the molecular formula C11H15F3N2O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-[methyl-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[methyl-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106216298 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-[methyl-[[1-(trifluoromethyl)cyclopropyl]carbamoyl]amino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)NC1(C(F)(F)F)CC1)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H15F3N2O4/c1-16(7-5-20-4-6(7)8(17)18)9(19)15-10(2-3-10)11(12,13)14/h6-7H,2-5H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | BPDXNUXOMMJYPT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |