C13H24N2O4 — CID 115432637
4-[[2-(aminomethyl)-2-ethylbutanoyl]-methylamino]oxolane-3-carboxylic acid (PubChem CID 115432637) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 4-[[2-(aminomethyl)-2-ethylbutanoyl]-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-(aminomethyl)-2-ethylbutanoyl]-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115432637 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-[[2-(aminomethyl)-2-ethylbutanoyl]-methylamino]oxolane-3-carboxylic acid |
| SMILES | CCC(CC)(CN)C(=O)N(C)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H24N2O4/c1-4-13(5-2,8-14)12(18)15(3)10-7-19-6-9(10)11(16)17/h9-10H,4-8,14H2,1-3H3,(H,16,17) |
| InChIKey | DTPIKRCBXFHAEW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |