C7H11F3N2O2S2 — CID 106217531
2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]propanethioamide (PubChem CID 106217531) has the molecular formula C7H11F3N2O2S2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]propanethioamide.
| Compound Name | 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]propanethioamide |
|---|---|
| PubChem CID | 106217531 |
| Molecular Formula | C7H11F3N2O2S2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]propanethioamide |
| SMILES | CC(C(N)=S)S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11F3N2O2S2/c1-4(5(11)15)16(13,14)12-6(2-3-6)7(8,9)10/h4,12H,2-3H2,1H3,(H2,11,15) |
| InChIKey | HBJQHAOOCQNVAE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|