C5H10F2N2O2S2 — CID 61118851
2-(difluoromethylsulfonylamino)-2-methylpropanethioamide (PubChem CID 61118851) has the molecular formula C5H10F2N2O2S2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)-2-methylpropanethioamide.
| Compound Name | 2-(difluoromethylsulfonylamino)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 61118851 |
| Molecular Formula | C5H10F2N2O2S2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)-2-methylpropanethioamide |
| SMILES | CC(C)(NS(=O)(=O)C(F)F)C(N)=S |
| InChI | InChI=1S/C5H10F2N2O2S2/c1-5(2,3(8)12)9-13(10,11)4(6)7/h4,9H,1-2H3,(H2,8,12) |
| InChIKey | WGWLJZQSOFILNR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|