C4H8F2N2O2S2 — CID 61123041
2-(difluoromethylsulfonylamino)propanethioamide (PubChem CID 61123041) has the molecular formula C4H8F2N2O2S2 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)propanethioamide.
| Compound Name | 2-(difluoromethylsulfonylamino)propanethioamide |
|---|---|
| PubChem CID | 61123041 |
| Molecular Formula | C4H8F2N2O2S2 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)propanethioamide |
| SMILES | CC(NS(=O)(=O)C(F)F)C(N)=S |
| InChI | InChI=1S/C4H8F2N2O2S2/c1-2(3(7)11)8-12(9,10)4(5)6/h2,4,8H,1H3,(H2,7,11) |
| InChIKey | IXYLSJCDEXMSPG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|