C6H12F2N2O2S2 — CID 61122650
2-(difluoromethylsulfonylamino)pentanethioamide (PubChem CID 61122650) has the molecular formula C6H12F2N2O2S2 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-(difluoromethylsulfonylamino)pentanethioamide.
| Compound Name | 2-(difluoromethylsulfonylamino)pentanethioamide |
|---|---|
| PubChem CID | 61122650 |
| Molecular Formula | C6H12F2N2O2S2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(difluoromethylsulfonylamino)pentanethioamide |
| SMILES | CCCC(NS(=O)(=O)C(F)F)C(N)=S |
| InChI | InChI=1S/C6H12F2N2O2S2/c1-2-3-4(5(9)13)10-14(11,12)6(7)8/h4,6,10H,2-3H2,1H3,(H2,9,13) |
| InChIKey | ONBLGADJVMNSJH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|