C11H14BrFN2O2S2 — CID 116527541
2-[(4-bromo-2-fluorophenyl)sulfonylamino]pentanethioamide (PubChem CID 116527541) has the molecular formula C11H14BrFN2O2S2 and a molecular weight of 369.28 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)sulfonylamino]pentanethioamide.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]pentanethioamide |
|---|---|
| PubChem CID | 116527541 |
| Molecular Formula | C11H14BrFN2O2S2 |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)sulfonylamino]pentanethioamide |
| SMILES | CCCC(NS(=O)(=O)c1ccc(Br)cc1F)C(N)=S |
| InChI | InChI=1S/C11H14BrFN2O2S2/c1-2-3-9(11(14)18)15-19(16,17)10-5-4-7(12)6-8(10)13/h4-6,9,15H,2-3H2,1H3,(H2,14,18) |
| InChIKey | GJQRARKWKLCUNG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|