C6H14N2O2S2 — CID 61124476
2-(methanesulfonamido)-2-methylbutanethioamide (PubChem CID 61124476) has the molecular formula C6H14N2O2S2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(methanesulfonamido)-2-methylbutanethioamide.
| Compound Name | 2-(methanesulfonamido)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 61124476 |
| Molecular Formula | C6H14N2O2S2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-(methanesulfonamido)-2-methylbutanethioamide |
| SMILES | CCC(C)(NS(C)(=O)=O)C(N)=S |
| InChI | InChI=1S/C6H14N2O2S2/c1-4-6(2,5(7)11)8-12(3,9)10/h8H,4H2,1-3H3,(H2,7,11) |
| InChIKey | RTVBGKBGOPOLDV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|